C13H14ClN5OS — CID 24855351
N-(3-chloro-4-methylphenyl)-2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]acetamide (PubChem CID 24855351) has the molecular formula C13H14ClN5OS and a molecular weight of 323.81 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 24855351 |
| Molecular Formula | C13H14ClN5OS |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2csc(N=C(N)N)n2)cc1Cl |
| InChI | InChI=1S/C13H14ClN5OS/c1-7-2-3-8(4-10(7)14)17-11(20)5-9-6-21-13(18-9)19-12(15)16/h2-4,6H,5H2,1H3,(H,17,20)(H4,15,16,18,19) |
| InChIKey | QRHGMXCSUAXUNK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|