C13H13ClN6OS — CID 24855407
N-(4-cyanophenyl)-2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]acetamide;hydrochloride (PubChem CID 24855407) has the molecular formula C13H13ClN6OS and a molecular weight of 336.81 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]acetamide;hydrochloride.
| Compound Name | N-(4-cyanophenyl)-2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 24855407 |
| Molecular Formula | C13H13ClN6OS |
| Molecular Weight | 336.81 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-(4-cyanophenyl)-2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]acetamide;hydrochloride |
| SMILES | Cl.N#Cc1ccc(NC(=O)Cc2csc(N=C(N)N)n2)cc1 |
| InChI | InChI=1S/C13H12N6OS.ClH/c14-6-8-1-3-9(4-2-8)17-11(20)5-10-7-21-13(18-10)19-12(15)16;/h1-4,7H,5H2,(H,17,20)(H4,15,16,18,19);1H |
| InChIKey | LQKOJDVPWVPLGI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 130.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.81 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|