C18H17N5O2S — CID 24855603
2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 24855603) has the molecular formula C18H17N5O2S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24855603 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | NC(N)=Nc1nc(CC(=O)Nc2ccc(Oc3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C18H17N5O2S/c19-17(20)23-18-22-13(11-26-18)10-16(24)21-12-6-8-15(9-7-12)25-14-4-2-1-3-5-14/h1-9,11H,10H2,(H,21,24)(H4,19,20,22,23) |
| InChIKey | KCUKCCGIWFBSPP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|