C14H18ClN5O2S — CID 24855608
2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-(4-methoxy-2-methylphenyl)acetamide;hydrochloride (PubChem CID 24855608) has the molecular formula C14H18ClN5O2S and a molecular weight of 355.85 g/mol. Its IUPAC name is 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-(4-methoxy-2-methylphenyl)acetamide;hydrochloride.
| Compound Name | 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-(4-methoxy-2-methylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 24855608 |
| Molecular Formula | C14H18ClN5O2S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-(4-methoxy-2-methylphenyl)acetamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)Cc2csc(N=C(N)N)n2)c(C)c1.Cl |
| InChI | InChI=1S/C14H17N5O2S.ClH/c1-8-5-10(21-2)3-4-11(8)18-12(20)6-9-7-22-14(17-9)19-13(15)16;/h3-5,7H,6H2,1-2H3,(H,18,20)(H4,15,16,17,19);1H |
| InChIKey | IULIFRDYVLKYNT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|