C12H13ClFN5OS — CID 24855352
2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-(4-fluorophenyl)acetamide;hydrochloride (PubChem CID 24855352) has the molecular formula C12H13ClFN5OS and a molecular weight of 329.79 g/mol. Its IUPAC name is 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-(4-fluorophenyl)acetamide;hydrochloride.
| Compound Name | 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-(4-fluorophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 24855352 |
| Molecular Formula | C12H13ClFN5OS |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-(4-fluorophenyl)acetamide;hydrochloride |
| SMILES | Cl.NC(N)=Nc1nc(CC(=O)Nc2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C12H12FN5OS.ClH/c13-7-1-3-8(4-2-7)16-10(19)5-9-6-20-12(17-9)18-11(14)15;/h1-4,6H,5H2,(H,16,19)(H4,14,15,17,18);1H |
| InChIKey | LCVWCPSMLCWWLK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|