C10H10N4OS — CID 62795383
2-(2-amino-1,3-thiazol-4-yl)-N-pyridin-4-ylacetamide (PubChem CID 62795383) has the molecular formula C10H10N4OS and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-pyridin-4-ylacetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 62795383 |
| Molecular Formula | C10H10N4OS |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-pyridin-4-ylacetamide |
| SMILES | Nc1nc(CC(=O)Nc2ccncc2)cs1 |
| InChI | InChI=1S/C10H10N4OS/c11-10-14-8(6-16-10)5-9(15)13-7-1-3-12-4-2-7/h1-4,6H,5H2,(H2,11,14)(H,12,13,15) |
| InChIKey | AXPKVYJWOLPNJE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |