C12H11N3O2S — CID 62787747
N-(4-acetylphenyl)-2-amino-1,3-thiazole-4-carboxamide (PubChem CID 62787747) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-amino-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-acetylphenyl)-2-amino-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62787747 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N-(4-acetylphenyl)-2-amino-1,3-thiazole-4-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2csc(N)n2)cc1 |
| InChI | InChI=1S/C12H11N3O2S/c1-7(16)8-2-4-9(5-3-8)14-11(17)10-6-18-12(13)15-10/h2-6H,1H3,(H2,13,15)(H,14,17) |
| InChIKey | CIUVBJVKYQJGNQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |