C20H17N3O3S — CID 84550613
N-(4-acetylphenyl)-2-[(2-phenylacetyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 84550613) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[(2-phenylacetyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-acetylphenyl)-2-[(2-phenylacetyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 84550613 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-(4-acetylphenyl)-2-[(2-phenylacetyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2csc(NC(=O)Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H17N3O3S/c1-13(24)15-7-9-16(10-8-15)21-19(26)17-12-27-20(22-17)23-18(25)11-14-5-3-2-4-6-14/h2-10,12H,11H2,1H3,(H,21,26)(H,22,23,25) |
| InChIKey | DPXKZVMHZGIDRX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |