C12H11N3O2S — CID 16915429
2-[(2-phenylacetyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 16915429) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 2-[(2-phenylacetyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2-phenylacetyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16915429 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-[(2-phenylacetyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(NC(=O)Cc2ccccc2)n1 |
| InChI | InChI=1S/C12H11N3O2S/c13-11(17)9-7-18-12(14-9)15-10(16)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,13,17)(H,14,15,16) |
| InChIKey | GHISCDWQEBDPKK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |