C18H23N5O4S — CID 173156105
2-[6-(phenylmethoxycarbamoylamino)hexanoylamino]-1,3-thiazole-4-carboxamide (PubChem CID 173156105) has the molecular formula C18H23N5O4S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-[6-(phenylmethoxycarbamoylamino)hexanoylamino]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[6-(phenylmethoxycarbamoylamino)hexanoylamino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 173156105 |
| Molecular Formula | C18H23N5O4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[6-(phenylmethoxycarbamoylamino)hexanoylamino]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(NC(=O)CCCCCNC(=O)NOCc2ccccc2)n1 |
| InChI | InChI=1S/C18H23N5O4S/c19-16(25)14-12-28-18(21-14)22-15(24)9-5-2-6-10-20-17(26)23-27-11-13-7-3-1-4-8-13/h1,3-4,7-8,12H,2,5-6,9-11H2,(H2,19,25)(H2,20,23,26)(H,21,22,24) |
| InChIKey | XIJVGNOCDLFVLH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|