C17H18N2O4S — CID 169435852
ethyl (Z)-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]but-2-enoate (PubChem CID 169435852) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is ethyl (Z)-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]but-2-enoate.
| Compound Name | ethyl (Z)-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 169435852 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | ethyl (Z)-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]but-2-enoate |
| SMILES | C/C=C(\C(=O)OCC)c1csc(NC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C17H18N2O4S/c1-3-13(15(20)22-4-2)14-11-24-16(18-14)19-17(21)23-10-12-8-6-5-7-9-12/h3,5-9,11H,4,10H2,1-2H3,(H,18,19,21)/b13-3- |
| InChIKey | IEOYZKBSBBHCGU-DXNYSGJVSA-N |
| XLogP | 3.86 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|