C22H28N4O7S — CID 142485312
ethyl (2Z)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxyimino]-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 142485312) has the molecular formula C22H28N4O7S and a molecular weight of 492.55 g/mol. Its IUPAC name is ethyl (2Z)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxyimino]-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl (2Z)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxyimino]-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 142485312 |
| Molecular Formula | C22H28N4O7S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | ethyl (2Z)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxyimino]-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)/C(=N\OCCNC(=O)OC(C)(C)C)c1csc(NC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C22H28N4O7S/c1-5-30-18(27)17(26-32-12-11-23-20(28)33-22(2,3)4)16-14-34-19(24-16)25-21(29)31-13-15-9-7-6-8-10-15/h6-10,14H,5,11-13H2,1-4H3,(H,23,28)(H,24,25,29)/b26-17- |
| InChIKey | CKGFEKFWVYHCBR-ONUIUJJFSA-N |
| XLogP | 3.70 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|