C16H15N3O7S — CID 87932600
(2E)-2-(2-methoxy-2-oxoethoxy)imino-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 87932600) has the molecular formula C16H15N3O7S and a molecular weight of 393.38 g/mol. Its IUPAC name is (2E)-2-(2-methoxy-2-oxoethoxy)imino-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2E)-2-(2-methoxy-2-oxoethoxy)imino-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 87932600 |
| Molecular Formula | C16H15N3O7S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (2E)-2-(2-methoxy-2-oxoethoxy)imino-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | COC(=O)CO/N=C(/C(=O)O)c1csc(NC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C16H15N3O7S/c1-24-12(20)8-26-19-13(14(21)22)11-9-27-15(17-11)18-16(23)25-7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,21,22)(H,17,18,23)/b19-13+ |
| InChIKey | SSFNGCYJLWOLOI-CPNJWEJPSA-N |
| XLogP | 1.87 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|