C23H27N3O8S — CID 89252693
(2Z)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-(4-phenylmethoxycarbonyloxan-4-yl)oxyiminoacetic acid (PubChem CID 89252693) has the molecular formula C23H27N3O8S and a molecular weight of 505.55 g/mol. Its IUPAC name is (2Z)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-(4-phenylmethoxycarbonyloxan-4-yl)oxyiminoacetic acid.
| Compound Name | (2Z)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-(4-phenylmethoxycarbonyloxan-4-yl)oxyiminoacetic acid |
|---|---|
| PubChem CID | 89252693 |
| Molecular Formula | C23H27N3O8S |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | (2Z)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-(4-phenylmethoxycarbonyloxan-4-yl)oxyiminoacetic acid |
| SMILES | CC(C)(C)OC(=O)Nc1nc(/C(=N/OC2(C(=O)OCc3ccccc3)CCOCC2)C(=O)O)cs1 |
| InChI | InChI=1S/C23H27N3O8S/c1-22(2,3)33-21(30)25-20-24-16(14-35-20)17(18(27)28)26-34-23(9-11-31-12-10-23)19(29)32-13-15-7-5-4-6-8-15/h4-8,14H,9-13H2,1-3H3,(H,27,28)(H,24,25,30)/b26-17- |
| InChIKey | ULMLAIXGWRLCKG-ONUIUJJFSA-N |
| XLogP | 3.59 |
| TPSA | 145.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|