C17H18N4O6S — CID 135386932
(2Z)-2-(2-acetamidoethoxyimino)-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 135386932) has the molecular formula C17H18N4O6S and a molecular weight of 406.42 g/mol. Its IUPAC name is (2Z)-2-(2-acetamidoethoxyimino)-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2Z)-2-(2-acetamidoethoxyimino)-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 135386932 |
| Molecular Formula | C17H18N4O6S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | (2Z)-2-(2-acetamidoethoxyimino)-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CC(=O)NCCO/N=C(\C(=O)O)c1csc(NC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C17H18N4O6S/c1-11(22)18-7-8-27-21-14(15(23)24)13-10-28-16(19-13)20-17(25)26-9-12-5-3-2-4-6-12/h2-6,10H,7-9H2,1H3,(H,18,22)(H,23,24)(H,19,20,25)/b21-14- |
| InChIKey | FXLSXHLSJCBAPY-STZFKDTASA-N |
| XLogP | 1.83 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|