C12H18ClN3O4SSi — CID 88756843
(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-(2-trimethylsilylethoxyimino)acetic acid (PubChem CID 88756843) has the molecular formula C12H18ClN3O4SSi and a molecular weight of 363.90 g/mol. Its IUPAC name is (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-(2-trimethylsilylethoxyimino)acetic acid.
| Compound Name | (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-(2-trimethylsilylethoxyimino)acetic acid |
|---|---|
| PubChem CID | 88756843 |
| Molecular Formula | C12H18ClN3O4SSi |
| Molecular Weight | 363.90 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-(2-trimethylsilylethoxyimino)acetic acid |
| SMILES | C[Si](C)(C)CCO/N=C(\C(=O)O)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C12H18ClN3O4SSi/c1-22(2,3)5-4-20-16-10(11(18)19)8-7-21-12(14-8)15-9(17)6-13/h7H,4-6H2,1-3H3,(H,18,19)(H,14,15,17)/b16-10- |
| InChIKey | DVRQWNQQPRXCAB-YBEGLDIGSA-N |
| XLogP | 2.46 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.90 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|