C13H16ClN3O6S — CID 54419503
2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetic acid (PubChem CID 54419503) has the molecular formula C13H16ClN3O6S and a molecular weight of 377.81 g/mol. Its IUPAC name is 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetic acid.
| Compound Name | 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetic acid |
|---|---|
| PubChem CID | 54419503 |
| Molecular Formula | C13H16ClN3O6S |
| Molecular Weight | 377.81 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetic acid |
| SMILES | CC(C)(C)OC(=O)CON=C(C(=O)O)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C13H16ClN3O6S/c1-13(2,3)23-9(19)5-22-17-10(11(20)21)7-6-24-12(15-7)16-8(18)4-14/h6H,4-5H2,1-3H3,(H,20,21)(H,15,16,18) |
| InChIKey | VZUCDDUWXHKFBF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.81 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|