C7H5ClN2O4S — CID 13323080
2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoacetic acid (PubChem CID 13323080) has the molecular formula C7H5ClN2O4S and a molecular weight of 248.65 g/mol. Its IUPAC name is 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoacetic acid.
| Compound Name | 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 13323080 |
| Molecular Formula | C7H5ClN2O4S |
| Molecular Weight | 248.65 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoacetic acid |
| SMILES | O=C(CCl)Nc1nc(C(=O)C(=O)O)cs1 |
| InChI | InChI=1S/C7H5ClN2O4S/c8-1-4(11)10-7-9-3(2-15-7)5(12)6(13)14/h2H,1H2,(H,13,14)(H,9,10,11) |
| InChIKey | YMRVLINIIYCUHC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.65 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|