C6H6N2O5S — CID 162317113
2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetic acid;hydrate (PubChem CID 162317113) has the molecular formula C6H6N2O5S and a molecular weight of 218.19 g/mol. Its IUPAC name is 2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetic acid;hydrate.
| Compound Name | 2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetic acid;hydrate |
|---|---|
| PubChem CID | 162317113 |
| Molecular Formula | C6H6N2O5S |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetic acid;hydrate |
| SMILES | O.O=CNc1nc(C(=O)C(=O)O)cs1 |
| InChI | InChI=1S/C6H4N2O4S.H2O/c9-2-7-6-8-3(1-13-6)4(10)5(11)12;/h1-2H,(H,11,12)(H,7,8,9);1H2 |
| InChIKey | OJFNKSYYYSGTBY-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 127.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|