C10H13N3O4S — CID 54132484
2-butoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid (PubChem CID 54132484) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is 2-butoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid.
| Compound Name | 2-butoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 54132484 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-butoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid |
| SMILES | CCCCON=C(C(=O)O)c1csc(NC=O)n1 |
| InChI | InChI=1S/C10H13N3O4S/c1-2-3-4-17-13-8(9(15)16)7-5-18-10(12-7)11-6-14/h5-6H,2-4H2,1H3,(H,15,16)(H,11,12,14) |
| InChIKey | NVIASKNPYJLAOX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|