C14H19N3O6S — CID 54528151
2-(2-formamido-1,3-thiazol-4-yl)-2-[1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]oxyiminoacetic acid (PubChem CID 54528151) has the molecular formula C14H19N3O6S and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-(2-formamido-1,3-thiazol-4-yl)-2-[1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]oxyiminoacetic acid.
| Compound Name | 2-(2-formamido-1,3-thiazol-4-yl)-2-[1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]oxyiminoacetic acid |
|---|---|
| PubChem CID | 54528151 |
| Molecular Formula | C14H19N3O6S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-(2-formamido-1,3-thiazol-4-yl)-2-[1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]oxyiminoacetic acid |
| SMILES | CCC(ON=C(C(=O)O)c1csc(NC=O)n1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H19N3O6S/c1-5-9(12(21)22-14(2,3)4)23-17-10(11(19)20)8-6-24-13(16-8)15-7-18/h6-7,9H,5H2,1-4H3,(H,19,20)(H,15,16,18) |
| InChIKey | YUOUIIXEQDZPPC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|