C9H9N3O4S2 — CID 14326067
(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-(thietan-3-yloxyimino)acetic acid (PubChem CID 14326067) has the molecular formula C9H9N3O4S2 and a molecular weight of 287.32 g/mol. Its IUPAC name is (2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-(thietan-3-yloxyimino)acetic acid.
| Compound Name | (2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-(thietan-3-yloxyimino)acetic acid |
|---|---|
| PubChem CID | 14326067 |
| Molecular Formula | C9H9N3O4S2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | (2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-(thietan-3-yloxyimino)acetic acid |
| SMILES | O=CNc1nc(/C(=N/OC2CSC2)C(=O)O)cs1 |
| InChI | InChI=1S/C9H9N3O4S2/c13-4-10-9-11-6(3-18-9)7(8(14)15)12-16-5-1-17-2-5/h3-5H,1-2H2,(H,14,15)(H,10,11,13)/b12-7- |
| InChIKey | GSXBTFLCUDZLNE-GHXNOFRVSA-N |
| XLogP | 0.63 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|