C17H13N3O9S — CID 88735462
2-(3,4-diacetyloxybenzoyl)oxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid (PubChem CID 88735462) has the molecular formula C17H13N3O9S and a molecular weight of 435.37 g/mol. Its IUPAC name is 2-(3,4-diacetyloxybenzoyl)oxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid.
| Compound Name | 2-(3,4-diacetyloxybenzoyl)oxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 88735462 |
| Molecular Formula | C17H13N3O9S |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 2-(3,4-diacetyloxybenzoyl)oxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid |
| SMILES | CC(=O)Oc1ccc(C(=O)ON=C(C(=O)O)c2csc(NC=O)n2)cc1OC(C)=O |
| InChI | InChI=1S/C17H13N3O9S/c1-8(22)27-12-4-3-10(5-13(12)28-9(2)23)16(26)29-20-14(15(24)25)11-6-30-17(19-11)18-7-21/h3-7H,1-2H3,(H,24,25)(H,18,19,21) |
| InChIKey | KZVMVBMCJJRJIB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 170.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|