C7H8ClN3O4S — CID 173181360
2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid;hydrochloride (PubChem CID 173181360) has the molecular formula C7H8ClN3O4S and a molecular weight of 265.68 g/mol. Its IUPAC name is 2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid;hydrochloride.
| Compound Name | 2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid;hydrochloride |
|---|---|
| PubChem CID | 173181360 |
| Molecular Formula | C7H8ClN3O4S |
| Molecular Weight | 265.68 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid;hydrochloride |
| SMILES | CON=C(C(=O)O)c1csc(NC=O)n1.Cl |
| InChI | InChI=1S/C7H7N3O4S.ClH/c1-14-10-5(6(12)13)4-2-15-7(9-4)8-3-11;/h2-3H,1H3,(H,12,13)(H,8,9,11);1H |
| InChIKey | RTTVRLLLGVXJAY-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.68 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|