C25H24N4O3S — CID 173355793
azane;2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 173355793) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is azane;2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | azane;2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 173355793 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | azane;2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CON=C(C(=O)O)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1.N |
| InChI | InChI=1S/C25H21N3O3S.H3N/c1-31-28-22(23(29)30)21-17-32-24(26-21)27-25(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;/h2-17H,1H3,(H,26,27)(H,29,30);1H3 |
| InChIKey | PIQRSJJGDAGRAR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|