C50H40N6O5S2 — CID 54189993
[2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl] 2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 54189993) has the molecular formula C50H40N6O5S2 and a molecular weight of 869.04 g/mol. Its IUPAC name is [2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl] 2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | [2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl] 2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 54189993 |
| Molecular Formula | C50H40N6O5S2 |
| Molecular Weight | 869.04 g/mol |
| Exact Mass | 868.25 |
| IUPAC Name | [2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl] 2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CON=C(C(=O)OC(=O)C(=NOC)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C50H40N6O5S2/c1-59-55-43(41-33-62-47(51-41)53-49(35-21-9-3-10-22-35,36-23-11-4-12-24-36)37-25-13-5-14-26-37)45(57)61-46(58)44(56-60-2)42-34-63-48(52-42)54-50(38-27-15-6-16-28-38,39-29-17-7-18-30-39)40-31-19-8-20-32-40/h3-34H,1-2H3,(H,51,53)(H,52,54) |
| InChIKey | PHVJUKDRQZYDAI-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.04 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|