C26H24N4O2S — CID 54390459
2-ethoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide (PubChem CID 54390459) has the molecular formula C26H24N4O2S and a molecular weight of 456.57 g/mol. Its IUPAC name is 2-ethoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide.
| Compound Name | 2-ethoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 54390459 |
| Molecular Formula | C26H24N4O2S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-ethoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide |
| SMILES | CCON=C(C(N)=O)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C26H24N4O2S/c1-2-32-30-23(24(27)31)22-18-33-25(28-22)29-26(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-18H,2H2,1H3,(H2,27,31)(H,28,29) |
| InChIKey | KZTVMWNYYZVLSC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|