C29H25N3O3S — CID 54124335
ethyl 2-prop-2-ynoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 54124335) has the molecular formula C29H25N3O3S and a molecular weight of 495.60 g/mol. Its IUPAC name is ethyl 2-prop-2-ynoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-prop-2-ynoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 54124335 |
| Molecular Formula | C29H25N3O3S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | ethyl 2-prop-2-ynoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | C#CCON=C(C(=O)OCC)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C29H25N3O3S/c1-3-20-35-32-26(27(33)34-4-2)25-21-36-28(30-25)31-29(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h1,5-19,21H,4,20H2,2H3,(H,30,31) |
| InChIKey | NPXGGKSJMGCVLL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|