C30H32N3O3PS2 — CID 23198625
diethylphosphinothioyl (2Z)-2-ethoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 23198625) has the molecular formula C30H32N3O3PS2 and a molecular weight of 577.71 g/mol. Its IUPAC name is diethylphosphinothioyl (2Z)-2-ethoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | diethylphosphinothioyl (2Z)-2-ethoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 23198625 |
| Molecular Formula | C30H32N3O3PS2 |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | diethylphosphinothioyl (2Z)-2-ethoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCO/N=C(\C(=O)OP(=S)(CC)CC)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C30H32N3O3PS2/c1-4-35-33-27(28(34)36-37(38,5-2)6-3)26-22-39-29(31-26)32-30(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-22H,4-6H2,1-3H3,(H,31,32)/b33-27- |
| InChIKey | ROHILHMOSLTQCK-KGGMANCPSA-N |
| XLogP | 7.27 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|