C29H25Cl2N3O3S — CID 86742858
ethyl (2E)-2-(3,3-dichloroprop-2-enoxyimino)-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 86742858) has the molecular formula C29H25Cl2N3O3S and a molecular weight of 566.51 g/mol. Its IUPAC name is ethyl (2E)-2-(3,3-dichloroprop-2-enoxyimino)-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl (2E)-2-(3,3-dichloroprop-2-enoxyimino)-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 86742858 |
| Molecular Formula | C29H25Cl2N3O3S |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 565.10 |
| IUPAC Name | ethyl (2E)-2-(3,3-dichloroprop-2-enoxyimino)-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)/C(=N/OCC=C(Cl)Cl)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C29H25Cl2N3O3S/c1-2-36-27(35)26(34-37-19-18-25(30)31)24-20-38-28(32-24)33-29(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-18,20H,2,19H2,1H3,(H,32,33)/b34-26+ |
| InChIKey | SRAIGLQAWVGHKC-JJNGWGCYSA-N |
| XLogP | 7.15 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|