C30H28ClN3O4S — CID 90415590
tert-butyl 2-[(E)-[2-chloro-2-oxo-1-[2-(tritylamino)-1,3-thiazol-4-yl]ethylidene]amino]oxyacetate (PubChem CID 90415590) has the molecular formula C30H28ClN3O4S and a molecular weight of 562.09 g/mol. Its IUPAC name is tert-butyl 2-[(E)-[2-chloro-2-oxo-1-[2-(tritylamino)-1,3-thiazol-4-yl]ethylidene]amino]oxyacetate.
| Compound Name | tert-butyl 2-[(E)-[2-chloro-2-oxo-1-[2-(tritylamino)-1,3-thiazol-4-yl]ethylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 90415590 |
| Molecular Formula | C30H28ClN3O4S |
| Molecular Weight | 562.09 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | tert-butyl 2-[(E)-[2-chloro-2-oxo-1-[2-(tritylamino)-1,3-thiazol-4-yl]ethylidene]amino]oxyacetate |
| SMILES | CC(C)(C)OC(=O)CO/N=C(/C(=O)Cl)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C30H28ClN3O4S/c1-29(2,3)38-25(35)19-37-34-26(27(31)36)24-20-39-28(32-24)33-30(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18,20H,19H2,1-3H3,(H,32,33)/b34-26+ |
| InChIKey | GANKHENMASGMHR-JJNGWGCYSA-N |
| XLogP | 6.37 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.09 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|