C43H34N4O2S — CID 57294159
2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetamide (PubChem CID 57294159) has the molecular formula C43H34N4O2S and a molecular weight of 670.84 g/mol. Its IUPAC name is 2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetamide.
| Compound Name | 2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetamide |
|---|---|
| PubChem CID | 57294159 |
| Molecular Formula | C43H34N4O2S |
| Molecular Weight | 670.84 g/mol |
| Exact Mass | 670.24 |
| IUPAC Name | 2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetamide |
| SMILES | NC(=O)C(=NOC(c1ccccc1)(c1ccccc1)c1ccccc1)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C43H34N4O2S/c44-40(48)39(47-49-43(35-25-13-4-14-26-35,36-27-15-5-16-28-36)37-29-17-6-18-30-37)38-31-50-41(45-38)46-42(32-19-7-1-8-20-32,33-21-9-2-10-22-33)34-23-11-3-12-24-34/h1-31H,(H2,44,48)(H,45,46) |
| InChIKey | SGDSZPKCQUENHC-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.84 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|