C47H42N4O4S — CID 170453471
(2Z)-N-(2,2-dimethoxyethyl)-2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetamide (PubChem CID 170453471) has the molecular formula C47H42N4O4S and a molecular weight of 758.94 g/mol. Its IUPAC name is (2Z)-N-(2,2-dimethoxyethyl)-2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetamide.
| Compound Name | (2Z)-N-(2,2-dimethoxyethyl)-2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetamide |
|---|---|
| PubChem CID | 170453471 |
| Molecular Formula | C47H42N4O4S |
| Molecular Weight | 758.94 g/mol |
| Exact Mass | 758.29 |
| IUPAC Name | (2Z)-N-(2,2-dimethoxyethyl)-2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetamide |
| SMILES | COC(CNC(=O)/C(=N\OC(c1ccccc1)(c1ccccc1)c1ccccc1)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1)OC |
| InChI | InChI=1S/C47H42N4O4S/c1-53-42(54-2)33-48-44(52)43(51-55-47(38-27-15-6-16-28-38,39-29-17-7-18-30-39)40-31-19-8-20-32-40)41-34-56-45(49-41)50-46(35-21-9-3-10-22-35,36-23-11-4-12-24-36)37-25-13-5-14-26-37/h3-32,34,42H,33H2,1-2H3,(H,48,52)(H,49,50)/b51-43- |
| InChIKey | WUPPJPMFSXBNRT-QHTNNWRJSA-N |
| XLogP | 8.99 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.94 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|