C26H20KN3O5S — CID 139769617
potassium 2-[2-(methoxycarbonylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetate (PubChem CID 139769617) has the molecular formula C26H20KN3O5S and a molecular weight of 525.63 g/mol. Its IUPAC name is potassium 2-[2-(methoxycarbonylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetate.
| Compound Name | potassium 2-[2-(methoxycarbonylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetate |
|---|---|
| PubChem CID | 139769617 |
| Molecular Formula | C26H20KN3O5S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | potassium 2-[2-(methoxycarbonylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetate |
| SMILES | COC(=O)Nc1nc(C(=NOC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)[O-])cs1.[K+] |
| InChI | InChI=1S/C26H21N3O5S.K/c1-33-25(32)28-24-27-21(17-35-24)22(23(30)31)29-34-26(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;/h2-17H,1H3,(H,30,31)(H,27,28,32);/q;+1/p-1 |
| InChIKey | NHBOGRKJSMWYDA-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|