C11H14N3O5S- — CID 19067212
(2Z)-2-methoxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 19067212) has the molecular formula C11H14N3O5S- and a molecular weight of 300.32 g/mol. Its IUPAC name is (2Z)-2-methoxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | (2Z)-2-methoxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 19067212 |
| Molecular Formula | C11H14N3O5S- |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (2Z)-2-methoxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | CO/N=C(\C(=O)[O-])c1csc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C11H15N3O5S/c1-11(2,3)19-10(17)13-9-12-6(5-20-9)7(8(15)16)14-18-4/h5H,1-4H3,(H,15,16)(H,12,13,17)/p-1/b14-7- |
| InChIKey | CXRMIVZMTLVVFN-AUWJEWJLSA-M |
| XLogP | 0.59 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|