C13H17N3O6S — CID 11013321
methyl (2Z)-2-acetyloxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 11013321) has the molecular formula C13H17N3O6S and a molecular weight of 343.36 g/mol. Its IUPAC name is methyl (2Z)-2-acetyloxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl (2Z)-2-acetyloxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 11013321 |
| Molecular Formula | C13H17N3O6S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | methyl (2Z)-2-acetyloxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)/C(=N\OC(C)=O)c1csc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C13H17N3O6S/c1-7(17)22-16-9(10(18)20-5)8-6-23-11(14-8)15-12(19)21-13(2,3)4/h6H,1-5H3,(H,14,15,19)/b16-9- |
| InChIKey | GOQVIXMUUJBKSY-SXGWCWSVSA-N |
| XLogP | 1.93 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|