C15H22N4O6S — CID 142667304
ethyl 2-methoxyimino-2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 142667304) has the molecular formula C15H22N4O6S and a molecular weight of 386.43 g/mol. Its IUPAC name is ethyl 2-methoxyimino-2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-methoxyimino-2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 142667304 |
| Molecular Formula | C15H22N4O6S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | ethyl 2-methoxyimino-2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)C(=NOC)c1csc(NC(=O)CNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C15H22N4O6S/c1-6-24-12(21)11(19-23-5)9-8-26-13(17-9)18-10(20)7-16-14(22)25-15(2,3)4/h8H,6-7H2,1-5H3,(H,16,22)(H,17,18,20) |
| InChIKey | PPWIBXYWPBKZSJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|