C12H15N3O6S — CID 139755450
ethyl 2-methoxyimino-2-[2-[(3-methoxy-2-oxopropanoyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 139755450) has the molecular formula C12H15N3O6S and a molecular weight of 329.33 g/mol. Its IUPAC name is ethyl 2-methoxyimino-2-[2-[(3-methoxy-2-oxopropanoyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-methoxyimino-2-[2-[(3-methoxy-2-oxopropanoyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 139755450 |
| Molecular Formula | C12H15N3O6S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | ethyl 2-methoxyimino-2-[2-[(3-methoxy-2-oxopropanoyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)C(=NOC)c1csc(NC(=O)C(=O)COC)n1 |
| InChI | InChI=1S/C12H15N3O6S/c1-4-21-11(18)9(15-20-3)7-6-22-12(13-7)14-10(17)8(16)5-19-2/h6H,4-5H2,1-3H3,(H,13,14,17) |
| InChIKey | OCIZEBCIHMIVAZ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|