C12H17N3O4S — CID 142637269
tert-butyl 2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetate (PubChem CID 142637269) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is tert-butyl 2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetate.
| Compound Name | tert-butyl 2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 142637269 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | tert-butyl 2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetate |
| SMILES | CON=C(C(=O)OC(C)(C)C)c1csc(NC(C)=O)n1 |
| InChI | InChI=1S/C12H17N3O4S/c1-7(16)13-11-14-8(6-20-11)9(15-18-5)10(17)19-12(2,3)4/h6H,1-5H3,(H,13,14,16) |
| InChIKey | LULNQXJAFLOUTD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|