C15H22N4O5S — CID 142637276
tert-butyl 2-[[2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]propanoate (PubChem CID 142637276) has the molecular formula C15H22N4O5S and a molecular weight of 370.43 g/mol. Its IUPAC name is tert-butyl 2-[[2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]propanoate.
| Compound Name | tert-butyl 2-[[2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]propanoate |
|---|---|
| PubChem CID | 142637276 |
| Molecular Formula | C15H22N4O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | tert-butyl 2-[[2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]propanoate |
| SMILES | CON=C(C(=O)NC(C)C(=O)OC(C)(C)C)c1csc(NC(C)=O)n1 |
| InChI | InChI=1S/C15H22N4O5S/c1-8(13(22)24-15(3,4)5)16-12(21)11(19-23-6)10-7-25-14(18-10)17-9(2)20/h7-8H,1-6H3,(H,16,21)(H,17,18,20) |
| InChIKey | BCVFWLBXUADKDJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|