C8H10N4O3S — CID 141367897
(2Z)-2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetamide (PubChem CID 141367897) has the molecular formula C8H10N4O3S and a molecular weight of 242.26 g/mol. Its IUPAC name is (2Z)-2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetamide.
| Compound Name | (2Z)-2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetamide |
|---|---|
| PubChem CID | 141367897 |
| Molecular Formula | C8H10N4O3S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (2Z)-2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetamide |
| SMILES | CO/N=C(\C(N)=O)c1csc(NC(C)=O)n1 |
| InChI | InChI=1S/C8H10N4O3S/c1-4(13)10-8-11-5(3-16-8)6(7(9)14)12-15-2/h3H,1-2H3,(H2,9,14)(H,10,11,13)/b12-6- |
| InChIKey | SOJWEFARTSXLJE-SDQBBNPISA-N |
| XLogP | -0.06 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|