C7H9N3O2S — CID 74007850
1-(2-amino-1,3-thiazol-4-yl)-1-methoxyiminopropan-2-one (PubChem CID 74007850) has the molecular formula C7H9N3O2S and a molecular weight of 199.24 g/mol. Its IUPAC name is 1-(2-amino-1,3-thiazol-4-yl)-1-methoxyiminopropan-2-one.
| Compound Name | 1-(2-amino-1,3-thiazol-4-yl)-1-methoxyiminopropan-2-one |
|---|---|
| PubChem CID | 74007850 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 1-(2-amino-1,3-thiazol-4-yl)-1-methoxyiminopropan-2-one |
| SMILES | CON=C(C(C)=O)c1csc(N)n1 |
| InChI | InChI=1S/C7H9N3O2S/c1-4(11)6(10-12-2)5-3-13-7(8)9-5/h3H,1-2H3,(H2,8,9) |
| InChIKey | GLGKNHIKOGIYJV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|