C12H13N3O2S2 — CID 174852867
(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioic S-acid;benzene (PubChem CID 174852867) has the molecular formula C12H13N3O2S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioic S-acid;benzene.
| Compound Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioic S-acid;benzene |
|---|---|
| PubChem CID | 174852867 |
| Molecular Formula | C12H13N3O2S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioic S-acid;benzene |
| SMILES | CO/N=C(\C(=O)S)c1csc(N)n1.c1ccccc1 |
| InChI | InChI=1S/C6H7N3O2S2.C6H6/c1-11-9-4(5(10)12)3-2-13-6(7)8-3;1-2-4-6-5-3-1/h2H,1H3,(H2,7,8)(H,10,12);1-6H/b9-4-; |
| InChIKey | ZHTKGADOKZSBJE-WONROIIJSA-N |
| XLogP | 2.22 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|