C7H9Cl2N3O4S — CID 173277547
2-acetyloxyimino-2-(2-amino-1,3-thiazol-4-yl)acetic acid;dihydrochloride (PubChem CID 173277547) has the molecular formula C7H9Cl2N3O4S and a molecular weight of 302.14 g/mol. Its IUPAC name is 2-acetyloxyimino-2-(2-amino-1,3-thiazol-4-yl)acetic acid;dihydrochloride.
| Compound Name | 2-acetyloxyimino-2-(2-amino-1,3-thiazol-4-yl)acetic acid;dihydrochloride |
|---|---|
| PubChem CID | 173277547 |
| Molecular Formula | C7H9Cl2N3O4S |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 2-acetyloxyimino-2-(2-amino-1,3-thiazol-4-yl)acetic acid;dihydrochloride |
| SMILES | CC(=O)ON=C(C(=O)O)c1csc(N)n1.Cl.Cl |
| InChI | InChI=1S/C7H7N3O4S.2ClH/c1-3(11)14-10-5(6(12)13)4-2-15-7(8)9-4;;/h2H,1H3,(H2,8,9)(H,12,13);2*1H |
| InChIKey | VHWBJAIBZXVBQS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|