C10H8F3N3O7S — CID 86745427
2-[[(2-amino-1,3-thiazol-4-yl)-carboxymethylidene]amino]oxyprop-2-enoic acid;2,2,2-trifluoroacetic acid (PubChem CID 86745427) has the molecular formula C10H8F3N3O7S and a molecular weight of 371.25 g/mol. Its IUPAC name is 2-[[(2-amino-1,3-thiazol-4-yl)-carboxymethylidene]amino]oxyprop-2-enoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(2-amino-1,3-thiazol-4-yl)-carboxymethylidene]amino]oxyprop-2-enoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86745427 |
| Molecular Formula | C10H8F3N3O7S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 2-[[(2-amino-1,3-thiazol-4-yl)-carboxymethylidene]amino]oxyprop-2-enoic acid;2,2,2-trifluoroacetic acid |
| SMILES | C=C(ON=C(C(=O)O)c1csc(N)n1)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H7N3O5S.C2HF3O2/c1-3(6(12)13)16-11-5(7(14)15)4-2-17-8(9)10-4;3-2(4,5)1(6)7/h2H,1H2,(H2,9,10)(H,12,13)(H,14,15);(H,6,7) |
| InChIKey | AEPGCGYQQVAGTK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|