C7H9N3O3S2 — CID 165345269
(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methylsulfanylmethoxyimino)acetic acid (PubChem CID 165345269) has the molecular formula C7H9N3O3S2 and a molecular weight of 247.30 g/mol. Its IUPAC name is (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methylsulfanylmethoxyimino)acetic acid.
| Compound Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methylsulfanylmethoxyimino)acetic acid |
|---|---|
| PubChem CID | 165345269 |
| Molecular Formula | C7H9N3O3S2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methylsulfanylmethoxyimino)acetic acid |
| SMILES | CSCO/N=C(\C(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C7H9N3O3S2/c1-14-3-13-10-5(6(11)12)4-2-15-7(8)9-4/h2H,3H2,1H3,(H2,8,9)(H,11,12)/b10-5- |
| InChIKey | ZBJWUEQQTQFMPT-YHYXMXQVSA-N |
| XLogP | 0.85 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|