C7H7Cl2N3O4S — CID 85059142
2-[[1-(2-amino-1,3-thiazol-4-yl)-2-chloro-2-oxoethylidene]amino]oxyacetic acid;hydrochloride (PubChem CID 85059142) has the molecular formula C7H7Cl2N3O4S and a molecular weight of 300.12 g/mol. Its IUPAC name is 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-chloro-2-oxoethylidene]amino]oxyacetic acid;hydrochloride.
| Compound Name | 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-chloro-2-oxoethylidene]amino]oxyacetic acid;hydrochloride |
|---|---|
| PubChem CID | 85059142 |
| Molecular Formula | C7H7Cl2N3O4S |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 298.95 |
| IUPAC Name | 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-chloro-2-oxoethylidene]amino]oxyacetic acid;hydrochloride |
| SMILES | Cl.Nc1nc(C(=NOCC(=O)O)C(=O)Cl)cs1 |
| InChI | InChI=1S/C7H6ClN3O4S.ClH/c8-6(14)5(11-15-1-4(12)13)3-2-16-7(9)10-3;/h2H,1H2,(H2,9,10)(H,12,13);1H |
| InChIKey | MXQMJHJCAVPARM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|