About (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide
(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide (PubChem CID 59874410) has the molecular formula C8H12N4O2S
and a molecular weight of 228.28 g/mol. Its IUPAC name is (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide.
Molecular Properties
| Compound Name | (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide |
| PubChem CID | 59874410 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide |
| SMILES | CCO/N=C(/C(=O)NC)c1csc(N)n1 |
| InChI | InChI=1S/C8H12N4O2S/c1-3-14-12-6(7(13)10-2)5-4-15-8(9)11-5/h4H,3H2,1-2H3,(H2,9,11)(H,10,13)/b12-6+ |
| InChIKey | UNWBCARXBVEFLW-WUXMJOGZSA-N |
| XLogP | 0.21 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide?
The IUPAC name of (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide (CID 59874410) is (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide.
What is the SMILES notation for (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide?
The canonical SMILES for (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide is CCO/N=C(/C(=O)NC)c1csc(N)n1.
What is the InChIKey of (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide?
The InChIKey is UNWBCARXBVEFLW-WUXMJOGZSA-N. The full InChI is InChI=1S/C8H12N4O2S/c1-3-14-12-6(7(13)10-2)5-4-15-8(9)11-5/h4H,3H2,1-2H3,(H2,9,11)(H,10,13)/b12-6+.
What are the key properties of (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide?
(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide has a molecular weight of 228.28 g/mol, XLogP of 0.21, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-methylacetamide is sourced from PubChem (CID 59874410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).