C14H15N3O3S — CID 139807125
benzyl 2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetate (PubChem CID 139807125) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is benzyl 2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetate.
| Compound Name | benzyl 2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetate |
|---|---|
| PubChem CID | 139807125 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | benzyl 2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetate |
| SMILES | CCON=C(C(=O)OCc1ccccc1)c1csc(N)n1 |
| InChI | InChI=1S/C14H15N3O3S/c1-2-20-17-12(11-9-21-14(15)16-11)13(18)19-8-10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H2,15,16) |
| InChIKey | DCRLUAZAPQURCO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|