C14H13Cl2N3O3S — CID 86742870
ethyl (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-[(2,6-dichlorophenyl)methoxyimino]acetate (PubChem CID 86742870) has the molecular formula C14H13Cl2N3O3S and a molecular weight of 374.25 g/mol. Its IUPAC name is ethyl (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-[(2,6-dichlorophenyl)methoxyimino]acetate.
| Compound Name | ethyl (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-[(2,6-dichlorophenyl)methoxyimino]acetate |
|---|---|
| PubChem CID | 86742870 |
| Molecular Formula | C14H13Cl2N3O3S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | ethyl (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-[(2,6-dichlorophenyl)methoxyimino]acetate |
| SMILES | CCOC(=O)/C(=N/OCc1c(Cl)cccc1Cl)c1csc(N)n1 |
| InChI | InChI=1S/C14H13Cl2N3O3S/c1-2-21-13(20)12(11-7-23-14(17)18-11)19-22-6-8-9(15)4-3-5-10(8)16/h3-5,7H,2,6H2,1H3,(H2,17,18)/b19-12+ |
| InChIKey | ICTBBPJNUXMIFA-XDHOZWIPSA-N |
| XLogP | 3.52 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|